C18H20N4O7S3 — CID 46252235
[2-ethoxy-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 46252235) has the molecular formula C18H20N4O7S3 and a molecular weight of 500.58 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [2-ethoxy-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 46252235 |
| Molecular Formula | C18H20N4O7S3 |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | [2-ethoxy-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | [H]/N=C1C(=C\c2ccc(OS(C)(=O)=O)c(OCC)c2)\C(=O)N=C2SN=C(S(=O)(=O)C(C)C)N2\1 |
| InChI | InChI=1S/C18H20N4O7S3/c1-5-28-14-9-11(6-7-13(14)29-31(4,24)25)8-12-15(19)22-17(20-16(12)23)30-21-18(22)32(26,27)10(2)3/h6-10,19H,5H2,1-4H3/b12-8-,19-15+ |
| InChIKey | IPTDFXMDZOUAEF-CCKNZYETSA-N |
| XLogP | 1.82 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|