C24H24N4O5S2 — CID 92660546
(6Z)-6-[[3-ethoxy-4-[(1R)-1-phenylethoxy]phenyl]methylidene]-3-ethylsulfonyl-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 92660546) has the molecular formula C24H24N4O5S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is (6Z)-6-[[3-ethoxy-4-[(1R)-1-phenylethoxy]phenyl]methylidene]-3-ethylsulfonyl-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[3-ethoxy-4-[(1R)-1-phenylethoxy]phenyl]methylidene]-3-ethylsulfonyl-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 92660546 |
| Molecular Formula | C24H24N4O5S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (6Z)-6-[[3-ethoxy-4-[(1R)-1-phenylethoxy]phenyl]methylidene]-3-ethylsulfonyl-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(O[C@H](C)c3ccccc3)c(OCC)c2)\C(=O)N=C2SN=C(S(=O)(=O)CC)N2\1 |
| InChI | InChI=1S/C24H24N4O5S2/c1-4-32-20-14-16(11-12-19(20)33-15(3)17-9-7-6-8-10-17)13-18-21(25)28-23(26-22(18)29)34-27-24(28)35(30,31)5-2/h6-15,25H,4-5H2,1-3H3/b18-13-,25-21+/t15-/m1/s1 |
| InChIKey | XFFJJBCNRCARKV-LYWLVKMQSA-N |
| XLogP | 4.24 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|