C25H26N6O3S — CID 6072569
(6E)-6-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6072569) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is (6E)-6-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6072569 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (6E)-6-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cc(C)n(-c3ccc(C)cc3)c2C)/C(=O)N=C2SC(CC(=O)N3CCOCC3)=NN2/1 |
| InChI | InChI=1S/C25H26N6O3S/c1-15-4-6-19(7-5-15)30-16(2)12-18(17(30)3)13-20-23(26)31-25(27-24(20)33)35-21(28-31)14-22(32)29-8-10-34-11-9-29/h4-7,12-13,26H,8-11,14H2,1-3H3/b20-13+,26-23- |
| InChIKey | JROIETWFUCPGNC-VOYPSTMSSA-N |
| XLogP | 3.27 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|