C20H16ClN5O3S — CID 46260094
(6E)-6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46260094) has the molecular formula C20H16ClN5O3S and a molecular weight of 441.90 g/mol. Its IUPAC name is (6E)-6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46260094 |
| Molecular Formula | C20H16ClN5O3S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (6E)-6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(-c3ccc(Cl)cc3)o2)/C(=O)N=C2SC(N3CCOCC3)=NN2/1 |
| InChI | InChI=1S/C20H16ClN5O3S/c21-13-3-1-12(2-4-13)16-6-5-14(29-16)11-15-17(22)26-19(23-18(15)27)30-20(24-26)25-7-9-28-10-8-25/h1-6,11,22H,7-10H2/b15-11+,22-17- |
| InChIKey | WFGNYOQSDSOVRN-JLWZUKIZSA-N |
| XLogP | 3.51 |
| TPSA | 94.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|