C26H20N4O4S — CID 2184001
ethyl 4-[5-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2184001) has the molecular formula C26H20N4O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2184001 |
| Molecular Formula | C26H20N4O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | ethyl 4-[5-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(-c3ccc(C(=O)OCC)cc3)o2)/C(=O)N=C2SC(c3ccccc3C)=NN2/1 |
| InChI | InChI=1S/C26H20N4O4S/c1-3-33-25(32)17-10-8-16(9-11-17)21-13-12-18(34-21)14-20-22(27)30-26(28-23(20)31)35-24(29-30)19-7-5-4-6-15(19)2/h4-14,27H,3H2,1-2H3/b20-14-,27-22- |
| InChIKey | CWXRFNWFPUNJDN-AYYXRDHQSA-N |
| XLogP | 5.10 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|