C26H20N4O4S — CID 41222179
4-[5-[(E)-[5-imino-7-oxo-2-[(1R)-1-phenylpropyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 41222179) has the molecular formula C26H20N4O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is 4-[5-[(E)-[5-imino-7-oxo-2-[(1R)-1-phenylpropyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-[5-imino-7-oxo-2-[(1R)-1-phenylpropyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 41222179 |
| Molecular Formula | C26H20N4O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-[5-[(E)-[5-imino-7-oxo-2-[(1R)-1-phenylpropyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | [H]/N=C1C(=C\c2ccc(-c3ccc(C(=O)O)cc3)o2)/C(=O)N=C2SC([C@H](CC)c3ccccc3)=NN2/1 |
| InChI | InChI=1S/C26H20N4O4S/c1-2-19(15-6-4-3-5-7-15)24-29-30-22(27)20(23(31)28-26(30)35-24)14-18-12-13-21(34-18)16-8-10-17(11-9-16)25(32)33/h3-14,19,27H,2H2,1H3,(H,32,33)/b20-14+,27-22-/t19-/m1/s1 |
| InChIKey | CLBYOZYJQZJHLJ-GEVAQWIBSA-N |
| XLogP | 5.46 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|