C23H16ClNO5 — CID 2934836
ethyl 4-[5-[[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2934836) has the molecular formula C23H16ClNO5 and a molecular weight of 421.84 g/mol. Its IUPAC name is ethyl 4-[5-[[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2934836 |
| Molecular Formula | C23H16ClNO5 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | ethyl 4-[5-[[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3N=C(c4ccccc4Cl)OC3=O)o2)cc1 |
| InChI | InChI=1S/C23H16ClNO5/c1-2-28-22(26)15-9-7-14(8-10-15)20-12-11-16(29-20)13-19-23(27)30-21(25-19)17-5-3-4-6-18(17)24/h3-13H,2H2,1H3 |
| InChIKey | DJWLSDMYLSTQPP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|