C18H12ClN3O2S — CID 1007237
6-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 1007237) has the molecular formula C18H12ClN3O2S and a molecular weight of 369.83 g/mol. Its IUPAC name is 6-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 1007237 |
| Molecular Formula | C18H12ClN3O2S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 6-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccccc3Cl)o2)C(=O)N=C2SC(C)=CN21 |
| InChI | InChI=1S/C18H12ClN3O2S/c1-10-9-22-16(20)13(17(23)21-18(22)25-10)8-11-6-7-15(24-11)12-4-2-3-5-14(12)19/h2-9,20H,1H3/b13-8?,20-16+ |
| InChIKey | NFZAFRCHINXLPB-GXOKJZEKSA-N |
| XLogP | 4.77 |
| TPSA | 69.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|