C23H18F3N5O4S — CID 46254117
N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenoxy]ethoxy]phenyl]acetamide (PubChem CID 46254117) has the molecular formula C23H18F3N5O4S and a molecular weight of 517.49 g/mol. Its IUPAC name is N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenoxy]ethoxy]phenyl]acetamide.
| Compound Name | N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenoxy]ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 46254117 |
| Molecular Formula | C23H18F3N5O4S |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenoxy]ethoxy]phenyl]acetamide |
| SMILES | [H]/N=C1C(=C\c2ccc(OCCOc3ccc(NC(C)=O)cc3)cc2)/C(=O)N=C2SC(C(F)(F)F)=NN2/1 |
| InChI | InChI=1S/C23H18F3N5O4S/c1-13(32)28-15-4-8-17(9-5-15)35-11-10-34-16-6-2-14(3-7-16)12-18-19(27)31-22(29-20(18)33)36-21(30-31)23(24,25)26/h2-9,12,27H,10-11H2,1H3,(H,28,32)/b18-12+,27-19- |
| InChIKey | SGAJUJUIXHEJRN-YAWYFBLUSA-N |
| XLogP | 4.28 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|