C24H20F3N5O5S — CID 46254118
N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenoxy]ethoxy]phenyl]acetamide (PubChem CID 46254118) has the molecular formula C24H20F3N5O5S and a molecular weight of 547.52 g/mol. Its IUPAC name is N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenoxy]ethoxy]phenyl]acetamide.
| Compound Name | N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenoxy]ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 46254118 |
| Molecular Formula | C24H20F3N5O5S |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | N-[4-[2-[4-[(E)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenoxy]ethoxy]phenyl]acetamide |
| SMILES | [H]/N=C1C(=C\c2ccc(OCCOc3ccc(NC(C)=O)cc3)c(OC)c2)/C(=O)N=C2SC(C(F)(F)F)=NN2/1 |
| InChI | InChI=1S/C24H20F3N5O5S/c1-13(33)29-15-4-6-16(7-5-15)36-9-10-37-18-8-3-14(12-19(18)35-2)11-17-20(28)32-23(30-21(17)34)38-22(31-32)24(25,26)27/h3-8,11-12,28H,9-10H2,1-2H3,(H,29,33)/b17-11+,28-20- |
| InChIKey | HMAGAMRBRWILJE-KPQPQSLGSA-N |
| XLogP | 4.29 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|