C26H17FN4O3S — CID 2182802
[3-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 2182802) has the molecular formula C26H17FN4O3S and a molecular weight of 484.51 g/mol. Its IUPAC name is [3-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2182802 |
| Molecular Formula | C26H17FN4O3S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [3-[(Z)-[5-imino-2-(2-methylphenyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | [H]/N=C1C(=C/c2cccc(OC(=O)c3ccccc3F)c2)/C(=O)N=C2SC(c3ccccc3C)=NN2/1 |
| InChI | InChI=1S/C26H17FN4O3S/c1-15-7-2-3-10-18(15)24-30-31-22(28)20(23(32)29-26(31)35-24)14-16-8-6-9-17(13-16)34-25(33)19-11-4-5-12-21(19)27/h2-14,28H,1H3/b20-14-,28-22- |
| InChIKey | WEVFSBRRIPDMSE-BTLZJJNYSA-N |
| XLogP | 5.02 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|