C20H15ClN4O6S3 — CID 46251797
[2-chloro-6-ethoxy-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate (PubChem CID 46251797) has the molecular formula C20H15ClN4O6S3 and a molecular weight of 539.02 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-chloro-6-ethoxy-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46251797 |
| Molecular Formula | C20H15ClN4O6S3 |
| Molecular Weight | 539.02 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate |
| SMILES | [H]/N=C1C(=C\c2cc(Cl)c(OC(=O)c3cccs3)c(OCC)c2)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C20H15ClN4O6S3/c1-3-30-13-9-10(8-12(21)15(13)31-18(27)14-5-4-6-32-14)7-11-16(22)25-19(23-17(11)26)33-24-20(25)34(2,28)29/h4-9,22H,3H2,1-2H3/b11-7-,22-16+ |
| InChIKey | TULPLBIHDISDOM-QFWIXSRNSA-N |
| XLogP | 3.64 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.02 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|