C31H28N6O2S — CID 98176921
(6E)-6-[[1-[2-[2-[(2R)-butan-2-yl]phenoxy]ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 98176921) has the molecular formula C31H28N6O2S and a molecular weight of 548.67 g/mol. Its IUPAC name is (6E)-6-[[1-[2-[2-[(2R)-butan-2-yl]phenoxy]ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[1-[2-[2-[(2R)-butan-2-yl]phenoxy]ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 98176921 |
| Molecular Formula | C31H28N6O2S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (6E)-6-[[1-[2-[2-[(2R)-butan-2-yl]phenoxy]ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cn(CCOc3ccccc3[C@H](C)CC)c3ccccc23)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C31H28N6O2S/c1-3-20(2)23-10-5-7-13-27(23)39-16-15-36-19-22(24-11-4-6-12-26(24)36)17-25-28(32)37-31(34-29(25)38)40-30(35-37)21-9-8-14-33-18-21/h4-14,17-20,32H,3,15-16H2,1-2H3/b25-17+,32-28-/t20-/m1/s1 |
| InChIKey | JRVJUCZZXUJFAC-FXNHLCPTSA-N |
| XLogP | 6.30 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|