C29H25ClN4O5S — CID 3961119
2-benzyl-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3,5-dimethoxyphenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3961119) has the molecular formula C29H25ClN4O5S and a molecular weight of 577.06 g/mol. Its IUPAC name is 2-benzyl-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3,5-dimethoxyphenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-benzyl-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3,5-dimethoxyphenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3961119 |
| Molecular Formula | C29H25ClN4O5S |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 2-benzyl-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3,5-dimethoxyphenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(OC)c(OCCOc3ccccc3Cl)c(OC)c2)C(=O)N=C2SC(Cc3ccccc3)=NN21 |
| InChI | InChI=1S/C29H25ClN4O5S/c1-36-23-15-19(16-24(37-2)26(23)39-13-12-38-22-11-7-6-10-21(22)30)14-20-27(31)34-29(32-28(20)35)40-25(33-34)17-18-8-4-3-5-9-18/h3-11,14-16,31H,12-13,17H2,1-2H3/b20-14?,31-27+ |
| InChIKey | FGUCQIXIBUWBRG-YGOFAKPISA-N |
| XLogP | 5.68 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|