C27H29N5O2S — CID 6144109
(6Z)-2-cyclohexyl-5-imino-6-[[1-[2-(2-prop-2-enylphenoxy)ethyl]pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6144109) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is (6Z)-2-cyclohexyl-5-imino-6-[[1-[2-(2-prop-2-enylphenoxy)ethyl]pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-2-cyclohexyl-5-imino-6-[[1-[2-(2-prop-2-enylphenoxy)ethyl]pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6144109 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (6Z)-2-cyclohexyl-5-imino-6-[[1-[2-(2-prop-2-enylphenoxy)ethyl]pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cccn2CCOc2ccccc2CC=C)/C(=O)N=C2SC(C3CCCCC3)=NN2/1 |
| InChI | InChI=1S/C27H29N5O2S/c1-2-9-19-10-6-7-14-23(19)34-17-16-31-15-8-13-21(31)18-22-24(28)32-27(29-25(22)33)35-26(30-32)20-11-4-3-5-12-20/h2,6-8,10,13-15,18,20,28H,1,3-5,9,11-12,16-17H2/b22-18-,28-24- |
| InChIKey | WGFCSZNBENETPL-IRHOYIQTSA-N |
| XLogP | 5.50 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|