C24H26N6O2S — CID 46260207
(6E)-5-imino-2-(4-methylpiperidin-1-yl)-6-[[1-(2-phenoxyethyl)pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46260207) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is (6E)-5-imino-2-(4-methylpiperidin-1-yl)-6-[[1-(2-phenoxyethyl)pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-5-imino-2-(4-methylpiperidin-1-yl)-6-[[1-(2-phenoxyethyl)pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46260207 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (6E)-5-imino-2-(4-methylpiperidin-1-yl)-6-[[1-(2-phenoxyethyl)pyrrol-2-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2CCOc2ccccc2)/C(=O)N=C2SC(N3CCC(C)CC3)=NN2/1 |
| InChI | InChI=1S/C24H26N6O2S/c1-17-9-12-29(13-10-17)24-27-30-21(25)20(22(31)26-23(30)33-24)16-18-6-5-11-28(18)14-15-32-19-7-3-2-4-8-19/h2-8,11,16-17,25H,9-10,12-15H2,1H3/b20-16+,25-21- |
| InChIKey | XRWNVMNRFBHSTG-FTORQHCPSA-N |
| XLogP | 3.88 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|