C25H28N6O2S — CID 46260071
(6E)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]methylidene]-5-imino-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46260071) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is (6E)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]methylidene]-5-imino-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]methylidene]-5-imino-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46260071 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (6E)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]methylidene]-5-imino-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2CCOc2ccc(C)c(C)c2)/C(=O)N=C2SC(N3CCCCC3)=NN2/1 |
| InChI | InChI=1S/C25H28N6O2S/c1-17-8-9-20(15-18(17)2)33-14-13-29-12-6-7-19(29)16-21-22(26)31-24(27-23(21)32)34-25(28-31)30-10-4-3-5-11-30/h6-9,12,15-16,26H,3-5,10-11,13-14H2,1-2H3/b21-16+,26-22- |
| InChIKey | LNIDUFQNXMWLTP-LZKSQXKRSA-N |
| XLogP | 4.25 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|