C35H30N2O5 — CID 126091446
4-[[2-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126091446) has the molecular formula C35H30N2O5 and a molecular weight of 558.63 g/mol. Its IUPAC name is 4-[[2-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126091446 |
| Molecular Formula | C35H30N2O5 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 4-[[2-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H30N2O5/c1-3-11-28-20-25(22-31(41-4-2)33(28)42-23-24-16-18-27(19-17-24)35(39)40)21-30-32(26-12-7-5-8-13-26)36-37(34(30)38)29-14-9-6-10-15-29/h3,5-10,12-22H,1,4,11,23H2,2H3,(H,39,40)/b30-21- |
| InChIKey | NSXTZHOUVGTRSB-OFWBYEQRSA-N |
| XLogP | 6.93 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|