C28H20N2O5S — CID 139254274
[4-[(Z)-[5-oxo-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 139254274) has the molecular formula C28H20N2O5S and a molecular weight of 496.54 g/mol. Its IUPAC name is [4-[(Z)-[5-oxo-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-[5-oxo-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139254274 |
| Molecular Formula | C28H20N2O5S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [4-[(Z)-[5-oxo-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3\C(=O)ON=C3c3ccc(-c4ccccn4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H20N2O5S/c1-19-5-15-24(16-6-19)36(32,33)35-23-13-7-20(8-14-23)18-25-27(30-34-28(25)31)22-11-9-21(10-12-22)26-4-2-3-17-29-26/h2-18H,1H3/b25-18- |
| InChIKey | XCWBOMFSGVBAIC-BWAHOGKJSA-N |
| XLogP | 5.17 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|