C30H24ClN3O3 — CID 129439642
N-[(2Z,4Z)-1-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 129439642) has the molecular formula C30H24ClN3O3 and a molecular weight of 509.99 g/mol. Its IUPAC name is N-[(2Z,4Z)-1-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4Z)-1-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 129439642 |
| Molecular Formula | C30H24ClN3O3 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | N-[(2Z,4Z)-1-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | Cc1ccc(-c2ccc(C=NNC(=O)/C(=C/C=C\c3ccccc3)NC(=O)c3ccccc3)o2)cc1Cl |
| InChI | InChI=1S/C30H24ClN3O3/c1-21-15-16-24(19-26(21)31)28-18-17-25(37-28)20-32-34-30(36)27(14-8-11-22-9-4-2-5-10-22)33-29(35)23-12-6-3-7-13-23/h2-20H,1H3,(H,33,35)(H,34,36)/b11-8-,27-14-,32-20? |
| InChIKey | NQFDAHBUFPMQPN-DDQBTNHTSA-N |
| XLogP | 6.39 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|