C18H13Cl3N2O3S — CID 135613492
3-chloro-N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 135613492) has the molecular formula C18H13Cl3N2O3S and a molecular weight of 443.74 g/mol. Its IUPAC name is 3-chloro-N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135613492 |
| Molecular Formula | C18H13Cl3N2O3S |
| Molecular Weight | 443.74 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 3-chloro-N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1cc(Cl)c(Cl)c(/C=N/NC(=O)c2sc3ccccc3c2Cl)c1O |
| InChI | InChI=1S/C18H13Cl3N2O3S/c1-2-26-12-7-11(19)14(20)10(16(12)24)8-22-23-18(25)17-15(21)9-5-3-4-6-13(9)27-17/h3-8,24H,2H2,1H3,(H,23,25)/b22-8+ |
| InChIKey | RSGLEGBUSVISNE-GZIVZEMBSA-N |
| XLogP | 5.73 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|