C18H11Cl2N3OS — CID 136689728
3-chloro-N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 136689728) has the molecular formula C18H11Cl2N3OS and a molecular weight of 388.28 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 136689728 |
| Molecular Formula | C18H11Cl2N3OS |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 3-chloro-N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1c(Cl)[nH]c2ccccc12)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H11Cl2N3OS/c19-15-11-6-2-4-8-14(11)25-16(15)18(24)23-21-9-12-10-5-1-3-7-13(10)22-17(12)20/h1-9,22H,(H,23,24)/b21-9- |
| InChIKey | JBNHJXLVBXWVIV-NKVSQWTQSA-N |
| XLogP | 5.45 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|