C23H22Cl2N2O3 — CID 25251956
2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 25251956) has the molecular formula C23H22Cl2N2O3 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 25251956 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N/N=C\c2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O3/c1-23(2,3)15-7-9-16(10-8-15)29-14-21(28)27-26-13-17-11-12-20(30-17)18-5-4-6-19(24)22(18)25/h4-13H,14H2,1-3H3,(H,27,28)/b26-13- |
| InChIKey | COVDRCDVTNXPDN-ZMFRSBBQSA-N |
| XLogP | 6.08 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|