C23H23N3O5 — CID 38094420
2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 38094420) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 38094420 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N/N=C\c2ccc(-c3ccccc3[N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C23H23N3O5/c1-23(2,3)16-8-10-17(11-9-16)30-15-22(27)25-24-14-18-12-13-21(31-18)19-6-4-5-7-20(19)26(28)29/h4-14H,15H2,1-3H3,(H,25,27)/b24-14- |
| InChIKey | PYAOFZDHLAOSSF-OYKKKHCWSA-N |
| XLogP | 4.68 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|