C13H11N7O3 — CID 23739153
1-[[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine (PubChem CID 23739153) has the molecular formula C13H11N7O3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 1-[[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 23739153 |
| Molecular Formula | C13H11N7O3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-[[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine |
| SMILES | Cc1cc(-c2ccc(C=Nn3nnnc3N)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N7O3/c1-8-6-9(2-4-11(8)20(21)22)12-5-3-10(23-12)7-15-19-13(14)16-17-18-19/h2-7H,1H3,(H2,14,16,18) |
| InChIKey | MYBOJVLKHPMAHH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|