C12H16N8O2 — CID 4116677
1-[[4-(diethylamino)-3-nitrophenyl]methylideneamino]tetrazol-5-amine (PubChem CID 4116677) has the molecular formula C12H16N8O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[[4-(diethylamino)-3-nitrophenyl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[[4-(diethylamino)-3-nitrophenyl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 4116677 |
| Molecular Formula | C12H16N8O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[[4-(diethylamino)-3-nitrophenyl]methylideneamino]tetrazol-5-amine |
| SMILES | CCN(CC)c1ccc(C=Nn2nnnc2N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N8O2/c1-3-18(4-2)10-6-5-9(7-11(10)20(21)22)8-14-19-12(13)15-16-17-19/h5-8H,3-4H2,1-2H3,(H2,13,15,17) |
| InChIKey | DQINCBBONOCVSS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|