C9H7F3N6 — CID 5409747
1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]tetrazol-5-amine (PubChem CID 5409747) has the molecular formula C9H7F3N6 and a molecular weight of 256.19 g/mol. Its IUPAC name is 1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 5409747 |
| Molecular Formula | C9H7F3N6 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]tetrazol-5-amine |
| SMILES | Nc1nnnn1/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3N6/c10-9(11,12)7-3-1-6(2-4-7)5-14-18-8(13)15-16-17-18/h1-5H,(H2,13,15,17)/b14-5- |
| InChIKey | FCRZFINWKPQSHV-RZNTYIFUSA-N |
| XLogP | 1.16 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|