C15H13FN6O — CID 962360
1-[[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]tetrazol-5-amine (PubChem CID 962360) has the molecular formula C15H13FN6O and a molecular weight of 312.31 g/mol. Its IUPAC name is 1-[[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 962360 |
| Molecular Formula | C15H13FN6O |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]tetrazol-5-amine |
| SMILES | Nc1nnnn1N=Cc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H13FN6O/c16-13-6-4-11(5-7-13)10-23-14-3-1-2-12(8-14)9-18-22-15(17)19-20-21-22/h1-9H,10H2,(H2,17,19,21) |
| InChIKey | HQHSPSAFQUMFLP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|