C21H23N5O5S — CID 2911021
4-[4-[[4-(diethylamino)-3-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonamide (PubChem CID 2911021) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-[4-[[4-(diethylamino)-3-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[[4-(diethylamino)-3-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2911021 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-[4-[[4-(diethylamino)-3-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc(C=C2C(=O)N(c3ccc(S(N)(=O)=O)cc3)N=C2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N5O5S/c1-4-24(5-2)19-11-6-15(13-20(19)26(28)29)12-18-14(3)23-25(21(18)27)16-7-9-17(10-8-16)32(22,30)31/h6-13H,4-5H2,1-3H3,(H2,22,30,31) |
| InChIKey | WLORYGWROJLUQL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|