C17H12N4O7 — CID 6148327
6-[(E)-2-[5-(3-methyl-4-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 6148327) has the molecular formula C17H12N4O7 and a molecular weight of 384.30 g/mol. Its IUPAC name is 6-[(E)-2-[5-(3-methyl-4-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-2-[5-(3-methyl-4-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6148327 |
| Molecular Formula | C17H12N4O7 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 6-[(E)-2-[5-(3-methyl-4-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cc(-c2ccc(/C=C/c3[nH]c(=O)[nH]c(=O)c3[N+](=O)[O-])o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N4O7/c1-9-8-10(2-6-13(9)20(24)25)14-7-4-11(28-14)3-5-12-15(21(26)27)16(22)19-17(23)18-12/h2-8H,1H3,(H2,18,19,22,23)/b5-3+ |
| InChIKey | VTIZHBVHJPOYCV-HWKANZROSA-N |
| XLogP | 2.62 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|