C21H16N4O7 — CID 4280332
4-(methoxymethyl)-6-[2-[5-(4-methyl-3-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 4280332) has the molecular formula C21H16N4O7 and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-(methoxymethyl)-6-[2-[5-(4-methyl-3-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(methoxymethyl)-6-[2-[5-(4-methyl-3-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4280332 |
| Molecular Formula | C21H16N4O7 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-(methoxymethyl)-6-[2-[5-(4-methyl-3-nitrophenyl)furan-2-yl]ethenyl]-5-nitro-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COCc1c([N+](=O)[O-])c(C=Cc2ccc(-c3ccc(C)c([N+](=O)[O-])c3)o2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C21H16N4O7/c1-12-3-4-13(9-18(12)24(27)28)19-8-6-14(32-19)5-7-17-20(25(29)30)16(11-31-2)15(10-22)21(26)23-17/h3-9H,11H2,1-2H3,(H,23,26) |
| InChIKey | FCQDDHCKPAUYRE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|