C20H14ClN3O5 — CID 6047166
6-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-4-(methoxymethyl)-5-nitro-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 6047166) has the molecular formula C20H14ClN3O5 and a molecular weight of 411.80 g/mol. Its IUPAC name is 6-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-4-(methoxymethyl)-5-nitro-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-4-(methoxymethyl)-5-nitro-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6047166 |
| Molecular Formula | C20H14ClN3O5 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 6-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-4-(methoxymethyl)-5-nitro-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COCc1c([N+](=O)[O-])c(/C=C/c2ccc(-c3ccccc3Cl)o2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C20H14ClN3O5/c1-28-11-15-14(10-22)20(25)23-17(19(15)24(26)27)8-6-12-7-9-18(29-12)13-4-2-3-5-16(13)21/h2-9H,11H2,1H3,(H,23,25)/b8-6+ |
| InChIKey | DSRYFGHHTSYRCL-SOFGYWHQSA-N |
| XLogP | 4.38 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|