C17H12ClN3O5 — CID 3330609
6-[2-[5-(5-chloro-2-methylphenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 3330609) has the molecular formula C17H12ClN3O5 and a molecular weight of 373.75 g/mol. Its IUPAC name is 6-[2-[5-(5-chloro-2-methylphenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-[5-(5-chloro-2-methylphenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3330609 |
| Molecular Formula | C17H12ClN3O5 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 6-[2-[5-(5-chloro-2-methylphenyl)furan-2-yl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(C=Cc2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H12ClN3O5/c1-9-2-3-10(18)8-12(9)14-7-5-11(26-14)4-6-13-15(21(24)25)16(22)20-17(23)19-13/h2-8H,1H3,(H2,19,20,22,23) |
| InChIKey | MASGBBGPGRLFFD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|