C18H12ClN5O5 — CID 3319234
6-[2-[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 3319234) has the molecular formula C18H12ClN5O5 and a molecular weight of 413.78 g/mol. Its IUPAC name is 6-[2-[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3319234 |
| Molecular Formula | C18H12ClN5O5 |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 6-[2-[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C=Cc2cc(/N=N/c3cccc(Cl)c3)ccc2O)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C18H12ClN5O5/c19-11-2-1-3-12(9-11)22-23-13-5-7-15(25)10(8-13)4-6-14-16(24(28)29)17(26)21-18(27)20-14/h1-9,25H,(H2,20,21,26,27)/b6-4?,23-22+ |
| InChIKey | VSXZFGABHWHEOT-QRYSZISRSA-N |
| XLogP | 3.92 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|