C19H14FN3O5 — CID 126319306
6-[(E)-2-[2-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 126319306) has the molecular formula C19H14FN3O5 and a molecular weight of 383.34 g/mol. Its IUPAC name is 6-[(E)-2-[2-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-2-[2-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126319306 |
| Molecular Formula | C19H14FN3O5 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 6-[(E)-2-[2-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(/C=C/c2ccccc2OCc2ccc(F)cc2)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C19H14FN3O5/c20-14-8-5-12(6-9-14)11-28-16-4-2-1-3-13(16)7-10-15-17(23(26)27)18(24)22-19(25)21-15/h1-10H,11H2,(H2,21,22,24,25)/b10-7+ |
| InChIKey | HUIKMUMKLAXODR-JXMROGBWSA-N |
| XLogP | 2.86 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|