C20H15BrClN3O6 — CID 126324432
6-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 126324432) has the molecular formula C20H15BrClN3O6 and a molecular weight of 508.71 g/mol. Its IUPAC name is 6-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126324432 |
| Molecular Formula | C20H15BrClN3O6 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | 6-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | COc1cc(/C=C\c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15BrClN3O6/c1-30-16-9-12(4-7-15-17(25(28)29)19(26)24-20(27)23-15)8-14(21)18(16)31-10-11-2-5-13(22)6-3-11/h2-9H,10H2,1H3,(H2,23,24,26,27)/b7-4- |
| InChIKey | UQVATVSMPPZBPL-DAXSKMNVSA-N |
| XLogP | 4.15 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|