C21H16BrCl2N3O6 — CID 126324358
6-[(E)-2-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 126324358) has the molecular formula C21H16BrCl2N3O6 and a molecular weight of 557.18 g/mol. Its IUPAC name is 6-[(E)-2-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-2-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126324358 |
| Molecular Formula | C21H16BrCl2N3O6 |
| Molecular Weight | 557.18 g/mol |
| Exact Mass | 554.96 |
| IUPAC Name | 6-[(E)-2-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | CCOc1cc(/C=C/c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16BrCl2N3O6/c1-2-32-17-8-11(3-6-16-18(27(30)31)20(28)26-21(29)25-16)7-14(22)19(17)33-10-12-4-5-13(23)9-15(12)24/h3-9H,2,10H2,1H3,(H2,25,26,28,29)/b6-3+ |
| InChIKey | XRSAUBFPXZZGMN-ZZXKWVIFSA-N |
| XLogP | 5.19 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.18 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|