C21H17BrClN3O6 — CID 126347303
2-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 126347303) has the molecular formula C21H17BrClN3O6 and a molecular weight of 522.74 g/mol. Its IUPAC name is 2-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126347303 |
| Molecular Formula | C21H17BrClN3O6 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | 2-[(Z)-2-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(/C=C\c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17BrClN3O6/c1-2-31-16-10-13(5-8-17-24-20(27)18(26(29)30)21(28)25-17)9-15(22)19(16)32-11-12-3-6-14(23)7-4-12/h3-10H,2,11H2,1H3,(H2,24,25,27,28)/b8-5- |
| InChIKey | AIPXEWDLXICERK-YVMONPNESA-N |
| XLogP | 4.95 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|