C19H13I2N3O5 — CID 126356163
2-[(Z)-2-(3,5-diiodo-4-phenylmethoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 126356163) has the molecular formula C19H13I2N3O5 and a molecular weight of 617.14 g/mol. Its IUPAC name is 2-[(Z)-2-(3,5-diiodo-4-phenylmethoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-(3,5-diiodo-4-phenylmethoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126356163 |
| Molecular Formula | C19H13I2N3O5 |
| Molecular Weight | 617.14 g/mol |
| Exact Mass | 616.89 |
| IUPAC Name | 2-[(Z)-2-(3,5-diiodo-4-phenylmethoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(/C=C\c2cc(I)c(OCc3ccccc3)c(I)c2)nc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13I2N3O5/c20-13-8-12(6-7-15-22-18(25)16(24(27)28)19(26)23-15)9-14(21)17(13)29-10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,22,23,25,26)/b7-6- |
| InChIKey | YBDYBPDJJPLHTM-SREVYHEPSA-N |
| XLogP | 4.34 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.14 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|