C19H13BrClN3O5 — CID 2959540
2-[2-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 2959540) has the molecular formula C19H13BrClN3O5 and a molecular weight of 478.69 g/mol. Its IUPAC name is 2-[2-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 2959540 |
| Molecular Formula | C19H13BrClN3O5 |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | 2-[2-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C=Cc2ccc(OCc3ccccc3Cl)c(Br)c2)nc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13BrClN3O5/c20-13-9-11(5-7-15(13)29-10-12-3-1-2-4-14(12)21)6-8-16-22-18(25)17(24(27)28)19(26)23-16/h1-9H,10H2,(H2,22,23,25,26) |
| InChIKey | VACKMYIHWDTYBD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|