C12H8N4O6 — CID 126352446
4-hydroxy-5-nitro-2-[(Z)-2-(3-nitrophenyl)ethenyl]-1H-pyrimidin-6-one (PubChem CID 126352446) has the molecular formula C12H8N4O6 and a molecular weight of 304.22 g/mol. Its IUPAC name is 4-hydroxy-5-nitro-2-[(Z)-2-(3-nitrophenyl)ethenyl]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-nitro-2-[(Z)-2-(3-nitrophenyl)ethenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126352446 |
| Molecular Formula | C12H8N4O6 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-hydroxy-5-nitro-2-[(Z)-2-(3-nitrophenyl)ethenyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(/C=C\c2cccc([N+](=O)[O-])c2)nc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8N4O6/c17-11-10(16(21)22)12(18)14-9(13-11)5-4-7-2-1-3-8(6-7)15(19)20/h1-6H,(H2,13,14,17,18)/b5-4- |
| InChIKey | KLAXVGLTGVEIKB-PLNGDYQASA-N |
| XLogP | 1.46 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|