C18H13N5O8 — CID 126348652
4-hydroxy-2-[(Z)-2-[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]ethenyl]-5-nitro-1H-pyrimidin-6-one (PubChem CID 126348652) has the molecular formula C18H13N5O8 and a molecular weight of 427.33 g/mol. Its IUPAC name is 4-hydroxy-2-[(Z)-2-[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]ethenyl]-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-[(Z)-2-[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]ethenyl]-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126348652 |
| Molecular Formula | C18H13N5O8 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-hydroxy-2-[(Z)-2-[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]ethenyl]-5-nitro-1H-pyrimidin-6-one |
| SMILES | COc1cc(/C=C\c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C18H13N5O8/c1-30-13-8-10(3-6-14-20-17(24)16(23(28)29)18(25)21-14)2-5-12(13)31-15-7-4-11(9-19-15)22(26)27/h2-9H,1H3,(H2,20,21,24,25)/b6-3- |
| InChIKey | BWGGAROEZHMNJK-UTCJRWHESA-N |
| XLogP | 2.66 |
| TPSA | 183.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|