C22H20N4O8 — CID 126354422
2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 126354422) has the molecular formula C22H20N4O8 and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126354422 |
| Molecular Formula | C22H20N4O8 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C/c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C22H20N4O8/c1-32-15-6-4-3-5-14(15)23-19(27)12-34-16-9-7-13(11-17(16)33-2)8-10-18-24-21(28)20(26(30)31)22(29)25-18/h3-11H,12H2,1-2H3,(H,23,27)(H2,24,25,28,29)/b10-8+ |
| InChIKey | PAVLKFAIPILCQJ-CSKARUKUSA-N |
| XLogP | 2.59 |
| TPSA | 165.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|