C23H21BrN4O7 — CID 126312357
N-(4-bromo-2,3-dimethylphenyl)-2-[2-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetamide (PubChem CID 126312357) has the molecular formula C23H21BrN4O7 and a molecular weight of 545.35 g/mol. Its IUPAC name is N-(4-bromo-2,3-dimethylphenyl)-2-[2-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetamide.
| Compound Name | N-(4-bromo-2,3-dimethylphenyl)-2-[2-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126312357 |
| Molecular Formula | C23H21BrN4O7 |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | N-(4-bromo-2,3-dimethylphenyl)-2-[2-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C\c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])ccc1OCC(=O)Nc1ccc(Br)c(C)c1C |
| InChI | InChI=1S/C23H21BrN4O7/c1-12-13(2)16(8-6-15(12)24)25-20(29)11-35-18-9-5-14(10-19(18)34-3)4-7-17-21(28(32)33)22(30)27-23(31)26-17/h4-10H,11H2,1-3H3,(H,25,29)(H2,26,27,30,31)/b7-4- |
| InChIKey | YYDCSYJYEGYHCA-DAXSKMNVSA-N |
| XLogP | 3.55 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|