C26H28BrN3O5S — CID 4568403
N-(4-bromo-2,3-dimethylphenyl)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetamide (PubChem CID 4568403) has the molecular formula C26H28BrN3O5S and a molecular weight of 574.50 g/mol. Its IUPAC name is N-(4-bromo-2,3-dimethylphenyl)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-(4-bromo-2,3-dimethylphenyl)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 4568403 |
| Molecular Formula | C26H28BrN3O5S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | N-(4-bromo-2,3-dimethylphenyl)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetamide |
| SMILES | CCN1C(=O)C(=Cc2ccc(OCC(=O)Nc3ccc(Br)c(C)c3C)c(OC)c2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C26H28BrN3O5S/c1-6-29-24(32)18(25(33)30(7-2)26(29)36)12-17-8-11-21(22(13-17)34-5)35-14-23(31)28-20-10-9-19(27)15(3)16(20)4/h8-13H,6-7,14H2,1-5H3,(H,28,31) |
| InChIKey | SGKSLBPDOHZERX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|