C17H16IN3O8 — CID 126318258
ethyl 2-[2-iodo-6-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetate (PubChem CID 126318258) has the molecular formula C17H16IN3O8 and a molecular weight of 517.23 g/mol. Its IUPAC name is ethyl 2-[2-iodo-6-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-iodo-6-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126318258 |
| Molecular Formula | C17H16IN3O8 |
| Molecular Weight | 517.23 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | ethyl 2-[2-iodo-6-methoxy-4-[(Z)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C\c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H16IN3O8/c1-3-28-13(22)8-29-15-10(18)6-9(7-12(15)27-2)4-5-11-14(21(25)26)16(23)20-17(24)19-11/h4-7H,3,8H2,1-2H3,(H2,19,20,23,24)/b5-4- |
| InChIKey | JYJWJBNBAXATHL-PLNGDYQASA-N |
| XLogP | 1.70 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|