C22H21N3O7 — CID 4273981
6-[2-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 4273981) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is 6-[2-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4273981 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 6-[2-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | CCOc1cc(C=Cc2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C22H21N3O7/c1-2-30-19-14-15(8-10-17-20(25(28)29)21(26)24-22(27)23-17)9-11-18(19)32-13-12-31-16-6-4-3-5-7-16/h3-11,14H,2,12-13H2,1H3,(H2,23,24,26,27) |
| InChIKey | IHXZEUWBIHVEBE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|