C20H16ClN3O6 — CID 5349685
6-[(E)-2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 5349685) has the molecular formula C20H16ClN3O6 and a molecular weight of 429.82 g/mol. Its IUPAC name is 6-[(E)-2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5349685 |
| Molecular Formula | C20H16ClN3O6 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 6-[(E)-2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | COc1cc(/C=C/c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H16ClN3O6/c1-29-17-10-12(6-8-15-18(24(27)28)19(25)23-20(26)22-15)7-9-16(17)30-11-13-4-2-3-5-14(13)21/h2-10H,11H2,1H3,(H2,22,23,25,26)/b8-6+ |
| InChIKey | FSHFPFCUUWYLTP-SOFGYWHQSA-N |
| XLogP | 3.38 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|