C20H14FN3O7 — CID 6251633
[2-methoxy-4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 2-fluorobenzoate (PubChem CID 6251633) has the molecular formula C20H14FN3O7 and a molecular weight of 427.34 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 2-fluorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 6251633 |
| Molecular Formula | C20H14FN3O7 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | [2-methoxy-4-[(E)-2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 2-fluorobenzoate |
| SMILES | COc1cc(/C=C/c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])ccc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H14FN3O7/c1-30-16-10-11(6-8-14-17(24(28)29)18(25)23-20(27)22-14)7-9-15(16)31-19(26)12-4-2-3-5-13(12)21/h2-10H,1H3,(H2,22,23,25,27)/b8-6+ |
| InChIKey | GIEFJKBWWSHGHS-SOFGYWHQSA-N |
| XLogP | 2.51 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|