C14H12N4O8 — CID 66485416
2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 66485416) has the molecular formula C14H12N4O8 and a molecular weight of 364.27 g/mol. Its IUPAC name is 2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66485416 |
| Molecular Formula | C14H12N4O8 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | COc1cc(/C=C/c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H12N4O8/c1-25-9-5-7(8(17(21)22)6-10(9)26-2)3-4-11-15-13(19)12(18(23)24)14(20)16-11/h3-6H,1-2H3,(H2,15,16,19,20)/b4-3+ |
| InChIKey | KXHPUIKUPJRLJV-ONEGZZNKSA-N |
| XLogP | 1.48 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|